CAS 205826-77-3 appears in our catalog under these names: (3,4-Dimethoxy-5-hydroxyphenyl)acetone, 95%, (3,4-Dimethoxy-5-hydroxyphenyl)acetone. Offered by: Combi-blocks, Biosynth. Available pack sizes: 1g, 25g, 10g, 5g.
1-(3-hydroxy-4,5-dimethoxyphenyl)propan-2-one (CAS 205826-77-3) is a chemical compound with the molecular formula C11H14O4 and a molecular weight of 210.23 g/mol. IUPAC name: 1-(3-hydroxy-4,5-dimethoxyphenyl)propan-2-one. InChIKey: GBESPRDHIINELJ-UHFFFAOYSA-N.
| Molecular formula | C11H14O4 |
|---|---|
| Molecular weight | 210.23 g/mol |
| IUPAC name | 1-(3-hydroxy-4,5-dimethoxyphenyl)propan-2-one |
| InChIKey | GBESPRDHIINELJ-UHFFFAOYSA-N |
| SMILES | CC(=O)CC1=CC(=C(C(=C1)OC)OC)O |
Computed by PubChem (NCBI)