Products 2058326-37-5

CAS 2058326-37-5 is the registry number for 2-{3-Azabicyclo(3.1.0)hexan-3-yl}acetic acid hydrochloride. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.

Structural formula: {0} (CAS {1})

2-(3-azabicyclo[3.1.0]hexan-3-yl)acetic acid;hydrochloride (CAS 2058326-37-5) is a chemical compound with the molecular formula C7H12ClNO2 and a molecular weight of 177.63 g/mol. IUPAC name: 2-(3-azabicyclo[3.1.0]hexan-3-yl)acetic acid;hydrochloride. InChIKey: SMQCTOZNQFIZMP-UHFFFAOYSA-N.

Identity
Molecular formulaC7H12ClNO2
Molecular weight177.63 g/mol
IUPAC name2-(3-azabicyclo[3.1.0]hexan-3-yl)acetic acid;hydrochloride
InChIKeySMQCTOZNQFIZMP-UHFFFAOYSA-N
SMILESC1C2C1CN(C2)CC(=O)O.Cl

Computed by PubChem (NCBI)