CAS 20587-61-5 appears in our catalog under these names: 2-(2-Hydroxyethoxy)ethyl benzoate, 95%, 2-(2-Hydroxyethoxy)ethyl Benzoate, 2-(2-Hydroxyethoxy)ethyl benzoate, 97%, 2–(2–hydroxyethoxy)ethyl benzoate, Diethylene glycol monobenzoate, 95%, 95%. Offered by: Combi-blocks, TRC, AmBeed, GLPBio, Chemat. Available pack sizes: 1g, 250mg, 100mg, 2,5g, 10mg, 50mg, 25mg.
2-(2-hydroxyethoxy)ethyl benzoate (CAS 20587-61-5) is a chemical compound with the molecular formula C11H14O4 and a molecular weight of 210.23 g/mol. IUPAC name: 2-(2-hydroxyethoxy)ethyl benzoate. InChIKey: DNUPYEDSAQDUSO-UHFFFAOYSA-N.
| Molecular formula | C11H14O4 |
|---|---|
| Molecular weight | 210.23 g/mol |
| IUPAC name | 2-(2-hydroxyethoxy)ethyl benzoate |
| InChIKey | DNUPYEDSAQDUSO-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(=O)OCCOCCO |
Computed by PubChem (NCBI)