CAS 2059908-19-7 is the registry number for rac-(2R,3R)-2-(1-Ethyl-1H-imidazol-2-yl)oxolan-3-amine dihydrochloride. Offered by: Biosynth. Available pack sizes: 0,25g, 25mg.
(2R,3R)-2-(1-ethylimidazol-2-yl)oxolan-3-amine;dihydrochloride (CAS 2059908-19-7) is a chemical compound with the molecular formula C9H17Cl2N3O and a molecular weight of 254.15 g/mol. IUPAC name: (2R,3R)-2-(1-ethylimidazol-2-yl)oxolan-3-amine;dihydrochloride. InChIKey: SNGKCWPPGGAQCK-RHJRFJOKSA-N.
| Molecular formula | C9H17Cl2N3O |
|---|---|
| Molecular weight | 254.15 g/mol |
| IUPAC name | (2R,3R)-2-(1-ethylimidazol-2-yl)oxolan-3-amine;dihydrochloride |
| InChIKey | SNGKCWPPGGAQCK-RHJRFJOKSA-N |
| SMILES | CCN1C=CN=C1[C@H]2[C@@H](CCO2)N.Cl.Cl |
Computed by PubChem (NCBI)