CAS 2059975-31-2 appears in our catalog under these names: 4-(2,2-Dimethylmorpholin-4-yl)benzoic acid hydrochloride, 95%, 4-(2,2-Dimethylmorpholin-4-yl)benzoic acid hydrochloride. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
4-(2,2-dimethylmorpholin-4-yl)benzoic acid;hydrochloride (CAS 2059975-31-2) is a chemical compound with the molecular formula C13H18ClNO3 and a molecular weight of 271.74 g/mol. IUPAC name: 4-(2,2-dimethylmorpholin-4-yl)benzoic acid;hydrochloride. InChIKey: BMKYKNVAWYAPPR-UHFFFAOYSA-N.
| Molecular formula | C13H18ClNO3 |
|---|---|
| Molecular weight | 271.74 g/mol |
| IUPAC name | 4-(2,2-dimethylmorpholin-4-yl)benzoic acid;hydrochloride |
| InChIKey | BMKYKNVAWYAPPR-UHFFFAOYSA-N |
| SMILES | CC1(CN(CCO1)C2=CC=C(C=C2)C(=O)O)C.Cl |
Computed by PubChem (NCBI)