CAS 2060005-01-6 appears in our catalog under these names: 3-(5-Methyl-1,2,4-oxadiazol-3-yl)-8-azabicyclo(3.2.1)octane hydrochloride, 95%, 3-(5-Methyl-1,2,4-oxadiazol-3-yl)-8-azabicyclo(3.2.1)octane hydrochloride. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
3-(8-azabicyclo[3.2.1]octan-3-yl)-5-methyl-1,2,4-oxadiazole;hydrochloride (CAS 2060005-01-6) is a chemical compound with the molecular formula C10H16ClN3O and a molecular weight of 229.71 g/mol. IUPAC name: 3-(8-azabicyclo[3.2.1]octan-3-yl)-5-methyl-1,2,4-oxadiazole;hydrochloride. InChIKey: DVQGRPJEVNJPDP-UHFFFAOYSA-N.
| Molecular formula | C10H16ClN3O |
|---|---|
| Molecular weight | 229.71 g/mol |
| IUPAC name | 3-(8-azabicyclo[3.2.1]octan-3-yl)-5-methyl-1,2,4-oxadiazole;hydrochloride |
| InChIKey | DVQGRPJEVNJPDP-UHFFFAOYSA-N |
| SMILES | CC1=NC(=NO1)C2CC3CCC(C2)N3.Cl |
Computed by PubChem (NCBI)