Products 2060030-50-2
CAS 2060030-50-2 is the registry number for 1-Cyclopentyl-4,5,6,7-tetrahydro-1H-1,2,3-benzotriazole-6-carboxylic acid. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
3-cyclopentyl-4,5,6,7-tetrahydrobenzotriazole-5-carboxylic acid (CAS 2060030-50-2) is a chemical compound with the molecular formula C12H17N3O2 and a molecular weight of 235.28 g/mol. IUPAC name: 3-cyclopentyl-4,5,6,7-tetrahydrobenzotriazole-5-carboxylic acid. InChIKey: QCVDTIKTDICWMG-UHFFFAOYSA-N.
| Molecular formula | C12H17N3O2 |
|---|---|
| Molecular weight | 235.28 g/mol |
| IUPAC name | 3-cyclopentyl-4,5,6,7-tetrahydrobenzotriazole-5-carboxylic acid |
| InChIKey | QCVDTIKTDICWMG-UHFFFAOYSA-N |
| SMILES | C1CCC(C1)N2C3=C(CCC(C3)C(=O)O)N=N2 |
Computed by PubChem (NCBI)