Products 2060033-12-5
CAS 2060033-12-5 is the registry number for 3-(2,4-Dimethylphenoxy)aniline hydrochloride. Offered by: Biosynth. Available pack sizes: 1g, 100mg.
3-(2,4-dimethylphenoxy)aniline;hydrochloride (CAS 2060033-12-5) is a chemical compound with the molecular formula C14H16ClNO and a molecular weight of 249.73 g/mol. IUPAC name: 3-(2,4-dimethylphenoxy)aniline;hydrochloride. InChIKey: QYPSDKZEMSQCGR-UHFFFAOYSA-N.
| Molecular formula | C14H16ClNO |
|---|---|
| Molecular weight | 249.73 g/mol |
| IUPAC name | 3-(2,4-dimethylphenoxy)aniline;hydrochloride |
| InChIKey | QYPSDKZEMSQCGR-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1)OC2=CC=CC(=C2)N)C.Cl |
Computed by PubChem (NCBI)