Products 2060052-57-3
CAS 2060052-57-3 is the registry number for 2-(3-Amino-2-hydroxypropyl)-1,2-dihydroisoquinolin-1-one hydrochloride. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
2-(3-amino-2-hydroxypropyl)isoquinolin-1-one;hydrochloride (CAS 2060052-57-3) is a chemical compound with the molecular formula C12H15ClN2O2 and a molecular weight of 254.71 g/mol. IUPAC name: 2-(3-amino-2-hydroxypropyl)isoquinolin-1-one;hydrochloride. InChIKey: JJFNLYFLMUJKAI-UHFFFAOYSA-N.
| Molecular formula | C12H15ClN2O2 |
|---|---|
| Molecular weight | 254.71 g/mol |
| IUPAC name | 2-(3-amino-2-hydroxypropyl)isoquinolin-1-one;hydrochloride |
| InChIKey | JJFNLYFLMUJKAI-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C=CN(C2=O)CC(CN)O.Cl |
Computed by PubChem (NCBI)