CAS 2060057-38-5 appears in our catalog under these names: 5-Chloro-1H,1aH,6H,6aH-cyclopropa(a)inden-1-amine hydrochloride, 95%, 5-Chloro-1H,1aH,6H,6aH-cyclopropa(A)inden-1-amine hydrochloride. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 1g, 0,5g, 50mg.
5-chloro-1,1a,6,6a-tetrahydrocyclopropa[a]inden-1-amine;hydrochloride (CAS 2060057-38-5) is a chemical compound with the molecular formula C10H11Cl2N and a molecular weight of 216.10 g/mol. IUPAC name: 5-chloro-1,1a,6,6a-tetrahydrocyclopropa[a]inden-1-amine;hydrochloride. InChIKey: JAWBWUJJZLTWSM-UHFFFAOYSA-N.
| Molecular formula | C10H11Cl2N |
|---|---|
| Molecular weight | 216.10 g/mol |
| IUPAC name | 5-chloro-1,1a,6,6a-tetrahydrocyclopropa[a]inden-1-amine;hydrochloride |
| InChIKey | JAWBWUJJZLTWSM-UHFFFAOYSA-N |
| SMILES | C1C2C(C2N)C3=C1C(=CC=C3)Cl.Cl |
Computed by PubChem (NCBI)