CAS 2060588-57-8 is the registry number for 6-Chloro-1,1-dimethyl-1,3-dihydrofuro[3,4-c]pyridin-3-ol, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
6-chloro-1,1-dimethyl-3H-furo[3,4-c]pyridin-3-ol (CAS 2060588-57-8) is a chemical compound with the molecular formula C9H10ClNO2 and a molecular weight of 199.63 g/mol. IUPAC name: 6-chloro-1,1-dimethyl-3H-furo[3,4-c]pyridin-3-ol. InChIKey: XQXWYACRAPINSU-UHFFFAOYSA-N.
| Molecular formula | C9H10ClNO2 |
|---|---|
| Molecular weight | 199.63 g/mol |
| IUPAC name | 6-chloro-1,1-dimethyl-3H-furo[3,4-c]pyridin-3-ol |
| InChIKey | XQXWYACRAPINSU-UHFFFAOYSA-N |
| SMILES | CC1(C2=CC(=NC=C2C(O1)O)Cl)C |
Computed by PubChem (NCBI)