CAS 20632-43-3 appears in our catalog under these names: 3-Ureidobenzoic acid, 3-[(Aminocarbonyl)amino]benzoic acid, 95%. Offered by: Biosynth, Combi-blocks. Available pack sizes: 10g, 1g, 250mg, 25g, 5g.
3-(carbamoylamino)benzoic acid (CAS 20632-43-3) is a chemical compound with the molecular formula C8H8N2O3 and a molecular weight of 180.16 g/mol. IUPAC name: 3-(carbamoylamino)benzoic acid. InChIKey: RWDCBLOFRYIIOL-UHFFFAOYSA-N.
| Molecular formula | C8H8N2O3 |
|---|---|
| Molecular weight | 180.16 g/mol |
| IUPAC name | 3-(carbamoylamino)benzoic acid |
| InChIKey | RWDCBLOFRYIIOL-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)NC(=O)N)C(=O)O |
Computed by PubChem (NCBI)