CAS 20633-28-7 is the registry number for 3,3-Dimethyl-5-oxo-5-phenylpentanoic acid. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
3,3-dimethyl-5-oxo-5-phenylpentanoic acid (CAS 20633-28-7) is a chemical compound with the molecular formula C13H16O3 and a molecular weight of 220.26 g/mol. IUPAC name: 3,3-dimethyl-5-oxo-5-phenylpentanoic acid. InChIKey: DHWPIXISWZOLGV-UHFFFAOYSA-N.
| Molecular formula | C13H16O3 |
|---|---|
| Molecular weight | 220.26 g/mol |
| IUPAC name | 3,3-dimethyl-5-oxo-5-phenylpentanoic acid |
| InChIKey | DHWPIXISWZOLGV-UHFFFAOYSA-N |
| SMILES | CC(C)(CC(=O)C1=CC=CC=C1)CC(=O)O |
Computed by PubChem (NCBI)