CAS 2064338-07-2 appears in our catalog under these names: (3S)-tert-Butyl 3-methylazetidine-2-carboxylate hydrochloride, 98%, tert-Butyl (3S)-3-methylazetidine-2-carboxylate hydrochloride, 98%, 98%, tert-Butyl (3S)-3-methylazetidine-2-carboxylate hydrochloride, 98%. Offered by: AmBeed, Chemat, Fluorochem. Available pack sizes: 1g, 100mg, 250mg.
Tert-butyl (3S)-3-methylazetidine-2-carboxylate;hydrochloride (CAS 2064338-07-2) is a chemical compound with the molecular formula C9H18ClNO2 and a molecular weight of 207.70 g/mol. IUPAC name: tert-butyl (3S)-3-methylazetidine-2-carboxylate;hydrochloride. InChIKey: RLGSTIFPBGKORR-OXIGJRIQSA-N.
| Molecular formula | C9H18ClNO2 |
|---|---|
| Molecular weight | 207.70 g/mol |
| IUPAC name | tert-butyl (3S)-3-methylazetidine-2-carboxylate;hydrochloride |
| InChIKey | RLGSTIFPBGKORR-OXIGJRIQSA-N |
| SMILES | C[C@H]1CNC1C(=O)OC(C)(C)C.Cl |
Computed by PubChem (NCBI)