Products 2064338-10-7
CAS 2064338-10-7 is the registry number for (2R,3S)-1-((Benzyloxy)carbonyl)-2-(carboxymethyl)-3-methylazetidine-2-carboxylic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(2R,3S)-2-(carboxymethyl)-3-methyl-1-phenylmethoxycarbonylazetidine-2-carboxylic acid (CAS 2064338-10-7) is a chemical compound with the molecular formula C15H17NO6 and a molecular weight of 307.30 g/mol. IUPAC name: (2R,3S)-2-(carboxymethyl)-3-methyl-1-phenylmethoxycarbonylazetidine-2-carboxylic acid. InChIKey: FLXSHEDAVSGQKN-ZUZCIYMTSA-N.
| Molecular formula | C15H17NO6 |
|---|---|
| Molecular weight | 307.30 g/mol |
| IUPAC name | (2R,3S)-2-(carboxymethyl)-3-methyl-1-phenylmethoxycarbonylazetidine-2-carboxylic acid |
| InChIKey | FLXSHEDAVSGQKN-ZUZCIYMTSA-N |
| SMILES | C[C@H]1CN([C@@]1(CC(=O)O)C(=O)O)C(=O)OCC2=CC=CC=C2 |
Computed by PubChem (NCBI)