CAS 110351-93-4 appears in our catalog under these names: (4′S)-4′-Ethyl-7′,8′-dihydro-4′-hydroxyspiro[1,3-dioxolane-2,6′(3′H)-[1H]pyrano[3,4-f]indolizine]-3′,10′(4′H)-dione, 97%, 97%, Camptothecin Impurity 8, Exatecan intermediate 12 98%, Exatecan intermediate 12, 99.88%. Offered by: Chemat, Chemat Brand, Ambeed, MedChemExpress. Available pack sizes: 100mg, 250mg, 1g, on request, 5g, 500 mg, 100 mg, 1 g.
(4'S)-4'-ethyl-4'-hydroxyspiro[1,3-dioxolane-2,6'-7,8-dihydro-1H-pyrano[3,4-f]indolizine]-3',10'-dione (CAS 110351-93-4) is a chemical compound with the molecular formula C15H17NO6 and a molecular weight of 307.30 g/mol. IUPAC name: (4'S)-4'-ethyl-4'-hydroxyspiro[1,3-dioxolane-2,6'-7,8-dihydro-1H-pyrano[3,4-f]indolizine]-3',10'-dione. InChIKey: GHFZMAJAVDXFDR-AWEZNQCLSA-N.
| Molecular formula | C15H17NO6 |
|---|---|
| Molecular weight | 307.30 g/mol |
| IUPAC name | (4'S)-4'-ethyl-4'-hydroxyspiro[1,3-dioxolane-2,6'-7,8-dihydro-1H-pyrano[3,4-f]indolizine]-3',10'-dione |
| InChIKey | GHFZMAJAVDXFDR-AWEZNQCLSA-N |
| SMILES | CC[C@@]1(C2=C(COC1=O)C(=O)N3CCC4(C3=C2)OCCO4)O |
Computed by PubChem (NCBI)