CAS 2089316-36-7 appears in our catalog under these names: Methyl 5-acetoxy-2-methyl-1h-indole-3-carboxylate acetate, 95%, Methyl 5-acetoxy-2-methyl-1H-indole-3-carboxylate acetate, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 250mg, 100mg.
Acetic acid;methyl 5-acetyloxy-2-methyl-1H-indole-3-carboxylate (CAS 2089316-36-7) is a chemical compound with the molecular formula C15H17NO6 and a molecular weight of 307.30 g/mol. IUPAC name: acetic acid;methyl 5-acetyloxy-2-methyl-1H-indole-3-carboxylate. InChIKey: VUWQIVOJVUTWAX-UHFFFAOYSA-N.
| Molecular formula | C15H17NO6 |
|---|---|
| Molecular weight | 307.30 g/mol |
| IUPAC name | acetic acid;methyl 5-acetyloxy-2-methyl-1H-indole-3-carboxylate |
| InChIKey | VUWQIVOJVUTWAX-UHFFFAOYSA-N |
| SMILES | CC1=C(C2=C(N1)C=CC(=C2)OC(=O)C)C(=O)OC.CC(=O)O |
Computed by PubChem (NCBI)