Products 586396-27-2
CAS 586396-27-2 is the registry number for (3R,5S)-1-((Benzyloxy)carbonyl)-5-(methoxycarbonyl)pyrrolidine-3-carboxylic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(3R,5S)-5-methoxycarbonyl-1-phenylmethoxycarbonylpyrrolidine-3-carboxylic acid (CAS 586396-27-2) is a chemical compound with the molecular formula C15H17NO6 and a molecular weight of 307.30 g/mol. IUPAC name: (3R,5S)-5-methoxycarbonyl-1-phenylmethoxycarbonylpyrrolidine-3-carboxylic acid. InChIKey: LRGHQMSTVSRHIH-NEPJUHHUSA-N.
| Molecular formula | C15H17NO6 |
|---|---|
| Molecular weight | 307.30 g/mol |
| IUPAC name | (3R,5S)-5-methoxycarbonyl-1-phenylmethoxycarbonylpyrrolidine-3-carboxylic acid |
| InChIKey | LRGHQMSTVSRHIH-NEPJUHHUSA-N |
| SMILES | COC(=O)[C@@H]1C[C@H](CN1C(=O)OCC2=CC=CC=C2)C(=O)O |
Computed by PubChem (NCBI)