Products 2065-27-2
CAS 2065-27-2 appears in our catalog under these names: Methyl 2,6–dimethoxybenzoate, Methyl 2,6-dimethoxybenzoate, Methyl 2,6-dimethoxybenzoate 95%, Methyl 2,6-dimethoxybenzoate, 95%, 95%, Methyl 2,6-dimethoxybenzoate, 95%. Offered by: GLPBio, Biosynth, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 5g, 0,25g, 0,5g, 2g, 250mg, 10g, 25g.
Methyl 2,6-dimethoxybenzoate (CAS 2065-27-2) is a chemical compound with the molecular formula C10H12O4 and a molecular weight of 196.20 g/mol. IUPAC name: methyl 2,6-dimethoxybenzoate. InChIKey: XLXVNKPXOIYLLE-UHFFFAOYSA-N.
| Molecular formula | C10H12O4 |
|---|---|
| Molecular weight | 196.20 g/mol |
| IUPAC name | methyl 2,6-dimethoxybenzoate |
| InChIKey | XLXVNKPXOIYLLE-UHFFFAOYSA-N |
| SMILES | COC1=C(C(=CC=C1)OC)C(=O)OC |
Computed by PubChem (NCBI)