Products 2065250-22-6

CAS 2065250-22-6 is the registry number for 4-Amino-3-bromo-2-chloro-benzoic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.

Structural formula: {0} (CAS {1})

4-amino-3-bromo-2-chlorobenzoic acid (CAS 2065250-22-6) is a chemical compound with the molecular formula C7H5BrClNO2 and a molecular weight of 250.48 g/mol. IUPAC name: 4-amino-3-bromo-2-chlorobenzoic acid. InChIKey: JQGZKWZTBUUTQJ-UHFFFAOYSA-N.

Identity
Molecular formulaC7H5BrClNO2
Molecular weight250.48 g/mol
IUPAC name4-amino-3-bromo-2-chlorobenzoic acid
InChIKeyJQGZKWZTBUUTQJ-UHFFFAOYSA-N
SMILESC1=CC(=C(C(=C1C(=O)O)Cl)Br)N

Computed by PubChem (NCBI)