CAS 206555-32-0 is the registry number for 4-(3-Chlorophenyl)-5-methylthiazol-2-amine, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 10g, 25g, 5g.
4-(3-chlorophenyl)-5-methyl-1,3-thiazol-2-amine (CAS 206555-32-0) is a chemical compound with the molecular formula C10H9ClN2S and a molecular weight of 224.71 g/mol. IUPAC name: 4-(3-chlorophenyl)-5-methyl-1,3-thiazol-2-amine. InChIKey: IQMIPBOEPWSKSU-UHFFFAOYSA-N.
| Molecular formula | C10H9ClN2S |
|---|---|
| Molecular weight | 224.71 g/mol |
| IUPAC name | 4-(3-chlorophenyl)-5-methyl-1,3-thiazol-2-amine |
| InChIKey | IQMIPBOEPWSKSU-UHFFFAOYSA-N |
| SMILES | CC1=C(N=C(S1)N)C2=CC(=CC=C2)Cl |
Computed by PubChem (NCBI)