CAS 290835-51-7 appears in our catalog under these names: 5-(4-Chloro-benzyl)-thiazol-2-ylamine, 95%, 5-(4-Chlorobenzyl)thiazol-2-amine. Offered by: Combi-blocks, Biosynth. Available pack sizes: 1g, 250mg, 10g, 5g, 100mg.
5-[(4-chlorophenyl)methyl]-1,3-thiazol-2-amine (CAS 290835-51-7) is a chemical compound with the molecular formula C10H9ClN2S and a molecular weight of 224.71 g/mol. IUPAC name: 5-[(4-chlorophenyl)methyl]-1,3-thiazol-2-amine. InChIKey: KMPMCIAXAISHFL-UHFFFAOYSA-N.
| Molecular formula | C10H9ClN2S |
|---|---|
| Molecular weight | 224.71 g/mol |
| IUPAC name | 5-[(4-chlorophenyl)methyl]-1,3-thiazol-2-amine |
| InChIKey | KMPMCIAXAISHFL-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1CC2=CN=C(S2)N)Cl |
Computed by PubChem (NCBI)