CAS 40493-18-3 appears in our catalog under these names: 4-Chloro-5,6,7,8-tetrahydrobenzo[4,5]thieno[2,3-d]pyrimidine, 98%, 4-Chloro-5,6,7,8-tetrahydrobenzo[4,5]thieno[2,3-d]pyrimidine, 97%, 97%, 4-Chloro-5,6,7,8-tetrahydrobenzo[4,5]thieno[2,3-d]pyrimidine, 95%. Offered by: Combi-blocks, Chemat, Fluorochem, Ambeed. Available pack sizes: 5g, 1g, 25g, 10g, 100mg, 250mg.
4-chloro-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidine (CAS 40493-18-3) is a chemical compound with the molecular formula C10H9ClN2S and a molecular weight of 224.71 g/mol. IUPAC name: 4-chloro-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidine. InChIKey: PRNJDUCSVXTOTN-UHFFFAOYSA-N.
| Molecular formula | C10H9ClN2S |
|---|---|
| Molecular weight | 224.71 g/mol |
| IUPAC name | 4-chloro-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidine |
| InChIKey | PRNJDUCSVXTOTN-UHFFFAOYSA-N |
| SMILES | C1CCC2=C(C1)C3=C(S2)N=CN=C3Cl |
Computed by PubChem (NCBI)