Products 206556-03-8

CAS 206556-03-8 is the registry number for 4-(4-Chlorophenyl)-2,5-dimethylthiazole, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 10g, 25g, 5g.

Structural formula: {0} (CAS {1})

4-(4-chlorophenyl)-2,5-dimethyl-1,3-thiazole (CAS 206556-03-8) is a chemical compound with the molecular formula C11H10ClNS and a molecular weight of 223.72 g/mol. IUPAC name: 4-(4-chlorophenyl)-2,5-dimethyl-1,3-thiazole. InChIKey: JCIYECLJFNFOBG-UHFFFAOYSA-N.

Identity
Molecular formulaC11H10ClNS
Molecular weight223.72 g/mol
IUPAC name4-(4-chlorophenyl)-2,5-dimethyl-1,3-thiazole
InChIKeyJCIYECLJFNFOBG-UHFFFAOYSA-N
SMILESCC1=C(N=C(S1)C)C2=CC=C(C=C2)Cl

Computed by PubChem (NCBI)