CAS 206556-03-8 is the registry number for 4-(4-Chlorophenyl)-2,5-dimethylthiazole, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 10g, 25g, 5g.
4-(4-chlorophenyl)-2,5-dimethyl-1,3-thiazole (CAS 206556-03-8) is a chemical compound with the molecular formula C11H10ClNS and a molecular weight of 223.72 g/mol. IUPAC name: 4-(4-chlorophenyl)-2,5-dimethyl-1,3-thiazole. InChIKey: JCIYECLJFNFOBG-UHFFFAOYSA-N.
| Molecular formula | C11H10ClNS |
|---|---|
| Molecular weight | 223.72 g/mol |
| IUPAC name | 4-(4-chlorophenyl)-2,5-dimethyl-1,3-thiazole |
| InChIKey | JCIYECLJFNFOBG-UHFFFAOYSA-N |
| SMILES | CC1=C(N=C(S1)C)C2=CC=C(C=C2)Cl |
Computed by PubChem (NCBI)