CAS 921102-01-4 appears in our catalog under these names: 2-(Chloromethyl)-4-(4-methylphenyl)-1,3-thiazole, 2-(Chloromethyl)-4-(4-methylphenyl)-1,3-thiazole, 95%. Offered by: Biosynth, AmBeed. Available pack sizes: 50mg, 0,5g, 5g.
2-(chloromethyl)-4-(4-methylphenyl)-1,3-thiazole (CAS 921102-01-4) is a chemical compound with the molecular formula C11H10ClNS and a molecular weight of 223.72 g/mol. IUPAC name: 2-(chloromethyl)-4-(4-methylphenyl)-1,3-thiazole. InChIKey: OCCQMMOOYUNWAB-UHFFFAOYSA-N.
| Molecular formula | C11H10ClNS |
|---|---|
| Molecular weight | 223.72 g/mol |
| IUPAC name | 2-(chloromethyl)-4-(4-methylphenyl)-1,3-thiazole |
| InChIKey | OCCQMMOOYUNWAB-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)C2=CSC(=N2)CCl |
Computed by PubChem (NCBI)