Products 41963-17-1
CAS 41963-17-1 is the registry number for 4-(Chloromethyl)-2-(3-methylphenyl)-1,3-thiazole, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 250mg, 1g.
4-(chloromethyl)-2-(3-methylphenyl)-1,3-thiazole (CAS 41963-17-1) is a chemical compound with the molecular formula C11H10ClNS and a molecular weight of 223.72 g/mol. IUPAC name: 4-(chloromethyl)-2-(3-methylphenyl)-1,3-thiazole. InChIKey: QDKKLPBRPGKNLV-UHFFFAOYSA-N.
| Molecular formula | C11H10ClNS |
|---|---|
| Molecular weight | 223.72 g/mol |
| IUPAC name | 4-(chloromethyl)-2-(3-methylphenyl)-1,3-thiazole |
| InChIKey | QDKKLPBRPGKNLV-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC=C1)C2=NC(=CS2)CCl |
Computed by PubChem (NCBI)