CAS 20668-35-3 appears in our catalog under these names: 7,8-Dimethylquinoline, 98%, 7,8-Dimethylquinoline. Offered by: Combi-blocks, Biosynth. Available pack sizes: 1g, 5g, 2,5g.
7,8-dimethylquinoline (CAS 20668-35-3) is a chemical compound with the molecular formula C11H11N and a molecular weight of 157.21 g/mol. IUPAC name: 7,8-dimethylquinoline. InChIKey: XUBHBRFJFJLNMQ-UHFFFAOYSA-N.
| Molecular formula | C11H11N |
|---|---|
| Molecular weight | 157.21 g/mol |
| IUPAC name | 7,8-dimethylquinoline |
| InChIKey | XUBHBRFJFJLNMQ-UHFFFAOYSA-N |
| SMILES | CC1=C(C2=C(C=CC=N2)C=C1)C |
Computed by PubChem (NCBI)