CAS 206761-78-6 appears in our catalog under these names: (2S,3S)-2,3-Dihydroxy-4-oxo-4-(p-tolylamino)butanoic acid, 95+%, (-)-4'-Methyltartranilic acid, 98%. Offered by: AmBeed, Fluorochem. Available pack sizes: 10g, 1g, 2g.
(2S,3S)-2,3-dihydroxy-4-(4-methylanilino)-4-oxobutanoic acid (CAS 206761-78-6) is a chemical compound with the molecular formula C11H13NO5 and a molecular weight of 239.22 g/mol. IUPAC name: (2S,3S)-2,3-dihydroxy-4-(4-methylanilino)-4-oxobutanoic acid. InChIKey: XUPDOKFGWPFCPJ-IUCAKERBSA-N.
| Molecular formula | C11H13NO5 |
|---|---|
| Molecular weight | 239.22 g/mol |
| IUPAC name | (2S,3S)-2,3-dihydroxy-4-(4-methylanilino)-4-oxobutanoic acid |
| InChIKey | XUPDOKFGWPFCPJ-IUCAKERBSA-N |
| SMILES | CC1=CC=C(C=C1)NC(=O)[C@H]([C@@H](C(=O)O)O)O |
Computed by PubChem (NCBI)