Products 2068137-90-4
CAS 2068137-90-4 is the registry number for Carbamic acid, N-[(2S,3S)-2-methyl-3-azetidinyl]-, 1,1-dimethylethyl ester. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g.
Tert-butyl N-[(2S,3S)-2-methylazetidin-3-yl]carbamate (CAS 2068137-90-4) is a chemical compound with the molecular formula C9H18N2O2 and a molecular weight of 186.25 g/mol. IUPAC name: tert-butyl N-[(2S,3S)-2-methylazetidin-3-yl]carbamate. InChIKey: LXXPLHYWFLINDJ-BQBZGAKWSA-N.
| Molecular formula | C9H18N2O2 |
|---|---|
| Molecular weight | 186.25 g/mol |
| IUPAC name | tert-butyl N-[(2S,3S)-2-methylazetidin-3-yl]carbamate |
| InChIKey | LXXPLHYWFLINDJ-BQBZGAKWSA-N |
| SMILES | C[C@H]1[C@H](CN1)NC(=O)OC(C)(C)C |
Computed by PubChem (NCBI)