CAS 2068138-12-3 is the registry number for Exo-(1r,5s,6s)-3-benzyl-3-azabicyclo[3.1.1]heptan-6-amine, 95%. Offered by: Combi-blocks. Available pack sizes: 100mg.
(1R,5S)-3-benzyl-3-azabicyclo[3.1.1]heptan-6-amine (CAS 2068138-12-3) is a chemical compound with the molecular formula C13H18N2 and a molecular weight of 202.30 g/mol. IUPAC name: (1R,5S)-3-benzyl-3-azabicyclo[3.1.1]heptan-6-amine. InChIKey: PZBJODSAGVQRDZ-FUNVUKJBSA-N.
| Molecular formula | C13H18N2 |
|---|---|
| Molecular weight | 202.30 g/mol |
| IUPAC name | (1R,5S)-3-benzyl-3-azabicyclo[3.1.1]heptan-6-amine |
| InChIKey | PZBJODSAGVQRDZ-FUNVUKJBSA-N |
| SMILES | C1[C@@H]2CN(C[C@H]1C2N)CC3=CC=CC=C3 |
Computed by PubChem (NCBI)