CAS 206884-98-2 appears in our catalog under these names: Piraxostat, Niraxostat/ 98.05% (existing batch purity), Niraxostat, Niraxostat, 98.54%. Offered by: Hubei YoungXin, TargetMol, GLPBio, Biosynth, Chemat. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 200mg, 1mg, 5mg, 1 mg.
1-[3-cyano-4-(2,2-dimethylpropoxy)phenyl]pyrazole-4-carboxylic acid (CAS 206884-98-2) is a chemical compound with the molecular formula C16H17N3O3 and a molecular weight of 299.32 g/mol. IUPAC name: 1-[3-cyano-4-(2,2-dimethylpropoxy)phenyl]pyrazole-4-carboxylic acid. InChIKey: AETHRPHBGJAIBT-UHFFFAOYSA-N.
| Molecular formula | C16H17N3O3 |
|---|---|
| Molecular weight | 299.32 g/mol |
| IUPAC name | 1-[3-cyano-4-(2,2-dimethylpropoxy)phenyl]pyrazole-4-carboxylic acid |
| InChIKey | AETHRPHBGJAIBT-UHFFFAOYSA-N |
| SMILES | CC(C)(C)COC1=C(C=C(C=C1)N2C=C(C=N2)C(=O)O)C#N |
Computed by PubChem (NCBI)