CAS 701929-65-9 appears in our catalog under these names: Nampt activator-1, 98%, Nampt activator-1/ 99.98% (existing batch purity), Nampt activator–1, Nampt activator-1, Nampt activator-1, 98.63%. Offered by: AmBeed, TargetMol, GLPBio, Chemat, MedChemExpress. Available pack sizes: 25mg, 5mg, 10mg, 1mg, 50mg, 100mg, 500mg, 200mg.
Ethyl 4-(pyridin-4-ylmethylcarbamoylamino)benzoate (CAS 701929-65-9) is a chemical compound with the molecular formula C16H17N3O3 and a molecular weight of 299.32 g/mol. IUPAC name: ethyl 4-(pyridin-4-ylmethylcarbamoylamino)benzoate. InChIKey: LNIPYBUMGBKFKQ-UHFFFAOYSA-N.
| Molecular formula | C16H17N3O3 |
|---|---|
| Molecular weight | 299.32 g/mol |
| IUPAC name | ethyl 4-(pyridin-4-ylmethylcarbamoylamino)benzoate |
| InChIKey | LNIPYBUMGBKFKQ-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=CC=C(C=C1)NC(=O)NCC2=CC=NC=C2 |
Computed by PubChem (NCBI)