CAS 766473-61-4 appears in our catalog under these names: Posaconazole Impurity 156, Posaconazole Impurity 97. Offered by: Chemat Brand. Available pack sizes: on request.
4-[4-(2-nitrophenyl)piperazin-1-yl]phenol (CAS 766473-61-4) is a chemical compound with the molecular formula C16H17N3O3 and a molecular weight of 299.32 g/mol. IUPAC name: 4-[4-(2-nitrophenyl)piperazin-1-yl]phenol. InChIKey: RYTVDJONFGIBPE-UHFFFAOYSA-N.
| Molecular formula | C16H17N3O3 |
|---|---|
| Molecular weight | 299.32 g/mol |
| IUPAC name | 4-[4-(2-nitrophenyl)piperazin-1-yl]phenol |
| InChIKey | RYTVDJONFGIBPE-UHFFFAOYSA-N |
| SMILES | C1CN(CCN1C2=CC=C(C=C2)O)C3=CC=CC=C3[N+](=O)[O-] |
Computed by PubChem (NCBI)