CAS 20691-72-9 appears in our catalog under these names: 4-Iodo-2-nitroaniline, 4–Iodo–2–nitroaniline, 4-Iodo-2-nitroaniline, >98.0%(GC), 4-Iodo-2-nitroaniline, 98%, 98%, 4-Iodo-2-nitroaniline, 98%. Offered by: TRC, GLPBio, TCI, Chemat, Fluorochem. Available pack sizes: 100mg, 10mg, 50mg, 25g, 1g, 5g, 10g, 100g.
4-iodo-2-nitroaniline (CAS 20691-72-9) is a chemical compound with the molecular formula C6H5IN2O2 and a molecular weight of 264.02 g/mol. IUPAC name: 4-iodo-2-nitroaniline. InChIKey: QVCRSYXVWPPBFJ-UHFFFAOYSA-N.
| Molecular formula | C6H5IN2O2 |
|---|---|
| Molecular weight | 264.02 g/mol |
| IUPAC name | 4-iodo-2-nitroaniline |
| InChIKey | QVCRSYXVWPPBFJ-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1I)[N+](=O)[O-])N |
Computed by PubChem (NCBI)