CAS 6293-83-0 appears in our catalog under these names: 2-Iodo-4-nitroaniline, 2–Iodo–4–nitroaniline, 2-Iodo-4-nitroaniline, >98.0%(GC), 2-Iodo-4-nitroaniline 97%, 2-Iodo-4-nitroaniline, 97%, 97%. Offered by: TRC, GLPBio, TCI, Ambeed, Chemat. Available pack sizes: 100mg, 250mg, 500mg, 5g, 1g, 10g, 25g, 100g.
2-iodo-4-nitroaniline (CAS 6293-83-0) is a chemical compound with the molecular formula C6H5IN2O2 and a molecular weight of 264.02 g/mol. IUPAC name: 2-iodo-4-nitroaniline. InChIKey: LOLSEMNGXKAZBZ-UHFFFAOYSA-N.
| Molecular formula | C6H5IN2O2 |
|---|---|
| Molecular weight | 264.02 g/mol |
| IUPAC name | 2-iodo-4-nitroaniline |
| InChIKey | LOLSEMNGXKAZBZ-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1[N+](=O)[O-])I)N |
Computed by PubChem (NCBI)