CAS 261527-85-9 appears in our catalog under these names: 2-Iodo-3-nitroaniline, 95%, 2–Iodo–3–nitroaniline. Offered by: Combi-blocks, GLPBio. Available pack sizes: 250mg, 1g, 100mg.
2-iodo-3-nitroaniline (CAS 261527-85-9) is a chemical compound with the molecular formula C6H5IN2O2 and a molecular weight of 264.02 g/mol. IUPAC name: 2-iodo-3-nitroaniline. InChIKey: MNCRWCXZMAPTQW-UHFFFAOYSA-N.
| Molecular formula | C6H5IN2O2 |
|---|---|
| Molecular weight | 264.02 g/mol |
| IUPAC name | 2-iodo-3-nitroaniline |
| InChIKey | MNCRWCXZMAPTQW-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)[N+](=O)[O-])I)N |
Computed by PubChem (NCBI)