CAS 2070014-70-7 appears in our catalog under these names: 1–Benzyl–5–((tert–butyldimethylsilyl)oxy)piperidin–3–ol, 1-Benzyl-5-((tert-butyldimethylsilyl)oxy)piperidin-3-ol, 95%, 95%. Offered by: GLPBio, Chemat. Available pack sizes: 100mg, 250mg.
1-benzyl-5-[tert-butyl(dimethyl)silyl]oxypiperidin-3-ol (CAS 2070014-70-7) is a chemical compound with the molecular formula C18H31NO2Si and a molecular weight of 321.5 g/mol. IUPAC name: 1-benzyl-5-[tert-butyl(dimethyl)silyl]oxypiperidin-3-ol. InChIKey: LPKCLOBPWVYSOV-UHFFFAOYSA-N.
| Molecular formula | C18H31NO2Si |
|---|---|
| Molecular weight | 321.5 g/mol |
| IUPAC name | 1-benzyl-5-[tert-butyl(dimethyl)silyl]oxypiperidin-3-ol |
| InChIKey | LPKCLOBPWVYSOV-UHFFFAOYSA-N |
| SMILES | CC(C)(C)[Si](C)(C)OC1CC(CN(C1)CC2=CC=CC=C2)O |
Computed by PubChem (NCBI)