CAS 635299-82-0 is the registry number for ((2S,4S)-1-Benzyl-4-((tert-butyldimethylsilyl)oxy)pyrrolidin-2-yl)methanol, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
[(2S,4S)-1-benzyl-4-[tert-butyl(dimethyl)silyl]oxypyrrolidin-2-yl]methanol (CAS 635299-82-0) is a chemical compound with the molecular formula C18H31NO2Si and a molecular weight of 321.5 g/mol. IUPAC name: [(2S,4S)-1-benzyl-4-[tert-butyl(dimethyl)silyl]oxypyrrolidin-2-yl]methanol. InChIKey: NMJXKPOVBRWNHU-IRXDYDNUSA-N.
| Molecular formula | C18H31NO2Si |
|---|---|
| Molecular weight | 321.5 g/mol |
| IUPAC name | [(2S,4S)-1-benzyl-4-[tert-butyl(dimethyl)silyl]oxypyrrolidin-2-yl]methanol |
| InChIKey | NMJXKPOVBRWNHU-IRXDYDNUSA-N |
| SMILES | CC(C)(C)[Si](C)(C)O[C@H]1C[C@H](N(C1)CC2=CC=CC=C2)CO |
Computed by PubChem (NCBI)