CAS 825644-18-6 is the registry number for (3S,5R)-1-Benzyl-5-((tert-butyldimethylsilyl)oxy)piperidin-3-ol, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(3S,5R)-1-benzyl-5-[tert-butyl(dimethyl)silyl]oxypiperidin-3-ol (CAS 825644-18-6) is a chemical compound with the molecular formula C18H31NO2Si and a molecular weight of 321.5 g/mol. IUPAC name: (3S,5R)-1-benzyl-5-[tert-butyl(dimethyl)silyl]oxypiperidin-3-ol. InChIKey: LPKCLOBPWVYSOV-DLBZAZTESA-N.
| Molecular formula | C18H31NO2Si |
|---|---|
| Molecular weight | 321.5 g/mol |
| IUPAC name | (3S,5R)-1-benzyl-5-[tert-butyl(dimethyl)silyl]oxypiperidin-3-ol |
| InChIKey | LPKCLOBPWVYSOV-DLBZAZTESA-N |
| SMILES | CC(C)(C)[Si](C)(C)O[C@@H]1C[C@@H](CN(C1)CC2=CC=CC=C2)O |
Computed by PubChem (NCBI)