CAS 2070868-78-7 appears in our catalog under these names: (S)–4–(tert–Butyl)–2–(pyrimidin–2–yl)–4,5–dihydrooxazole, (S)-4-(tert-Butyl)-2-(pyrimidin-2-yl)-4,5-dihydrooxazole, 97%, 97%, (S)-4-(tert-Butyl)-2-(pyrimidin-2-yl)-4,5-dihydrooxazole, 97%. Offered by: GLPBio, Chemat, Fluorochem, Ambeed. Available pack sizes: 50mg, 100mg, 250mg, 1g.
(4S)-4-tert-butyl-2-pyrimidin-2-yl-4,5-dihydro-1,3-oxazole (CAS 2070868-78-7) is a chemical compound with the molecular formula C11H15N3O and a molecular weight of 205.26 g/mol. IUPAC name: (4S)-4-tert-butyl-2-pyrimidin-2-yl-4,5-dihydro-1,3-oxazole. InChIKey: BJVQEWQRCMCVLE-MRVPVSSYSA-N.
| Molecular formula | C11H15N3O |
|---|---|
| Molecular weight | 205.26 g/mol |
| IUPAC name | (4S)-4-tert-butyl-2-pyrimidin-2-yl-4,5-dihydro-1,3-oxazole |
| InChIKey | BJVQEWQRCMCVLE-MRVPVSSYSA-N |
| SMILES | CC(C)(C)[C@H]1COC(=N1)C2=NC=CC=N2 |
Computed by PubChem (NCBI)