Products 20736-28-1
CAS 20736-28-1 appears in our catalog under these names: 4,5-Dimethoxy-2-methylbenzoic acid, 98%, 4，5–Dimethoxy–2–methylbenzoic Acid, 4,5-Dimethoxy-2-methylbenzoic acid 97%, 4,5-Dimethoxy-2-methylbenzoic acid, 97%, 97%. Offered by: Combi-blocks, GLPBio, Ambeed, Chemat. Available pack sizes: 25g, 10g, 1g, 5g, 250mg, 100mg.
4,5-dimethoxy-2-methylbenzoic acid (CAS 20736-28-1) is a chemical compound with the molecular formula C10H12O4 and a molecular weight of 196.20 g/mol. IUPAC name: 4,5-dimethoxy-2-methylbenzoic acid. InChIKey: PRPBPUNVOHTNDA-UHFFFAOYSA-N.
| Molecular formula | C10H12O4 |
|---|---|
| Molecular weight | 196.20 g/mol |
| IUPAC name | 4,5-dimethoxy-2-methylbenzoic acid |
| InChIKey | PRPBPUNVOHTNDA-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1C(=O)O)OC)OC |
Computed by PubChem (NCBI)