CAS 207511-13-5 is the registry number for 2-Mercaptopyridine-N-oxide, sodium salt hydrate, 98%. Offered by: Thermo Scientific (Acros). Available pack sizes: 5g, 25g.
Sodium;1-oxidopyridin-1-ium-2-thiolate;hydrate (CAS 207511-13-5) is a chemical compound with the molecular formula C5H6NNaO2S and a molecular weight of 167.16 g/mol. IUPAC name: sodium;1-oxidopyridin-1-ium-2-thiolate;hydrate. InChIKey: HTJXGDXCIFMYMU-UHFFFAOYSA-M.
| Molecular formula | C5H6NNaO2S |
|---|---|
| Molecular weight | 167.16 g/mol |
| IUPAC name | sodium;1-oxidopyridin-1-ium-2-thiolate;hydrate |
| InChIKey | HTJXGDXCIFMYMU-UHFFFAOYSA-M |
| SMILES | C1=CC=[N+](C(=C1)[S-])[O-].O.[Na+] |
Computed by PubChem (NCBI)