CAS 2076-64-4 appears in our catalog under these names: 1-Phenyl-1H-1,2,3-triazol-4-amine, 1-Phenyl-1H-1,2,3-triazol-4-amine, 95%. Offered by: Biosynth, AmBeed. Available pack sizes: 50mg, 0,5g, 1g.
1-phenyltriazol-4-amine (CAS 2076-64-4) is a chemical compound with the molecular formula C8H8N4 and a molecular weight of 160.18 g/mol. IUPAC name: 1-phenyltriazol-4-amine. InChIKey: FOIKZZCOPIBALR-UHFFFAOYSA-N.
| Molecular formula | C8H8N4 |
|---|---|
| Molecular weight | 160.18 g/mol |
| IUPAC name | 1-phenyltriazol-4-amine |
| InChIKey | FOIKZZCOPIBALR-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)N2C=C(N=N2)N |
Computed by PubChem (NCBI)