Products 207605-47-8
CAS 207605-47-8 appears in our catalog under these names: Dl-threo-3-phenylserine hydrate, 98%, DL-3-Phenylserine Hydrate, DL–3–Phenylserine hydrate, 2-Amino-3-hydroxy-3-phenylpropanoic acid xhydrate. Offered by: Combi-blocks, TRC, GLPBio, Biosynth, Sigma-Aldrich. Available pack sizes: 25g, 5g, 1g, 2,5g, 500mg.
2-amino-3-hydroxy-3-phenylpropanoic acid;hydrate (CAS 207605-47-8) is a chemical compound with the molecular formula C9H13NO4 and a molecular weight of 199.20 g/mol. IUPAC name: 2-amino-3-hydroxy-3-phenylpropanoic acid;hydrate. InChIKey: DUGXBGWTWDCGNP-UHFFFAOYSA-N.
| Molecular formula | C9H13NO4 |
|---|---|
| Molecular weight | 199.20 g/mol |
| IUPAC name | 2-amino-3-hydroxy-3-phenylpropanoic acid;hydrate |
| InChIKey | DUGXBGWTWDCGNP-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(C(C(=O)O)N)O.O |
Computed by PubChem (NCBI)
Synonyms:
2-Amino-3-hydroxy-3-phenylpropanoic acid xhydrate, 2-amino-3-hydroxy-3-phenylpropanoic acid;hydrate, Dl-Threo-3-Phenylserine Hydrate, ss-?Hydroxy-?phenylalanine Hydrate, Phenylalanine, beta-hydroxy-, hydrate (9CI), 2-amino-3-hydroxy-3-phenylpropanoic acid, hydrate, DL-threo-3-Phenylserine hydrate_x000D_, 2-amino-3-hydroxy-3-phenylpropanoic acid hydrate