CAS 168762-94-5 appears in our catalog under these names: 4-(tert-Butoxycarbonylamino)but-2-ynoic acid, 95%, 4-((tert-Butoxycarbonyl)amino)but-2-ynoic acid, 98%, 4-(tert-Butoxycarbonylamino)but-2-ynoic Acid, 4-((tert-Butoxycarbonyl)amino)but-2-ynoic acid 95%, 4-(Tert-butoxycarbonylamino)but-2-ynoic acid, 95%, 95%. Offered by: Combi-blocks, AmBeed, Biosynth, Chemat, Fluorochem. Available pack sizes: 250mg, 500mg, 5g, 0,5g, 50mg, 100mg, 1g.
4-[(2-methylpropan-2-yl)oxycarbonylamino]but-2-ynoic acid (CAS 168762-94-5) is a chemical compound with the molecular formula C9H13NO4 and a molecular weight of 199.20 g/mol. IUPAC name: 4-[(2-methylpropan-2-yl)oxycarbonylamino]but-2-ynoic acid. InChIKey: UEFFBQMMDMUCRR-UHFFFAOYSA-N.
| Molecular formula | C9H13NO4 |
|---|---|
| Molecular weight | 199.20 g/mol |
| IUPAC name | 4-[(2-methylpropan-2-yl)oxycarbonylamino]but-2-ynoic acid |
| InChIKey | UEFFBQMMDMUCRR-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NCC#CC(=O)O |
Computed by PubChem (NCBI)