CAS 1956341-81-3 is the registry number for 4-(Aminomethyl)benzene-1,3-diol acetate salt, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g, 250mg.
Acetic acid;4-(aminomethyl)benzene-1,3-diol (CAS 1956341-81-3) is a chemical compound with the molecular formula C9H13NO4 and a molecular weight of 199.20 g/mol. IUPAC name: acetic acid;4-(aminomethyl)benzene-1,3-diol. InChIKey: FKELXWAEAPSEGE-UHFFFAOYSA-N.
| Molecular formula | C9H13NO4 |
|---|---|
| Molecular weight | 199.20 g/mol |
| IUPAC name | acetic acid;4-(aminomethyl)benzene-1,3-diol |
| InChIKey | FKELXWAEAPSEGE-UHFFFAOYSA-N |
| SMILES | CC(=O)O.C1=CC(=C(C=C1O)O)CN |
Computed by PubChem (NCBI)