Products 208121-63-5
CAS 208121-63-5 is the registry number for Alanine, N-[(4-fluorophenyl)sulfonyl]-2-methyl-, methyl ester. Offered by: Chemat. Available pack sizes: 1g.
Methyl 2-[(4-fluorophenyl)sulfonylamino]-2-methylpropanoate (CAS 208121-63-5) is a chemical compound with the molecular formula C11H14FNO4S and a molecular weight of 275.30 g/mol. IUPAC name: methyl 2-[(4-fluorophenyl)sulfonylamino]-2-methylpropanoate. InChIKey: BCURRONPCVLKQE-UHFFFAOYSA-N.
| Molecular formula | C11H14FNO4S |
|---|---|
| Molecular weight | 275.30 g/mol |
| IUPAC name | methyl 2-[(4-fluorophenyl)sulfonylamino]-2-methylpropanoate |
| InChIKey | BCURRONPCVLKQE-UHFFFAOYSA-N |
| SMILES | CC(C)(C(=O)OC)NS(=O)(=O)C1=CC=C(C=C1)F |
Computed by PubChem (NCBI)