CAS 2082-76-0 appears in our catalog under these names: Decanoic anhydride, 98%, Decanoicanhydride, 98%, Decanoic Anhydride, Decanoic anhydride, Decanoic Anhydride, >98.0%(GC). Offered by: Combi-blocks, AmBeed, GLPBio, Biosynth, TCI. Available pack sizes: 25g, 5g, 1g, 100g, 10g, 50g, 100 mg, 250 mg.
Decanoyl decanoate (CAS 2082-76-0) is a chemical compound with the molecular formula C20H38O3 and a molecular weight of 326.5 g/mol. IUPAC name: decanoyl decanoate. InChIKey: HTWWKYKIBSHDPC-UHFFFAOYSA-N.
| Molecular formula | C20H38O3 |
|---|---|
| Molecular weight | 326.5 g/mol |
| IUPAC name | decanoyl decanoate |
| InChIKey | HTWWKYKIBSHDPC-UHFFFAOYSA-N |
| SMILES | CCCCCCCCCC(=O)OC(=O)CCCCCCCCC |
Computed by PubChem (NCBI)