Products 9004-96-0
CAS 9004-96-0 appears in our catalog under these names: Poly(ethylene glycol) Monooleate, Poly(ethylene glycol) Monooleate (Technical Grade ~70%), Poly(ethylene glycol) Monooleate (MW=860), Polyoxyl Oleate average Mn ~860, Polyoxyl Oleate, average Mn ~860. Offered by: TRC, MedChemExpress, Ambeed, BLDpharm, Sigma-Aldrich. Available pack sizes: 10ml, 25ml, 5ml, 500 mg, 250 mg, 100 mg, 50 mg, 1000g.
2-hydroxyethyl (Z)-octadec-9-enoate (CAS 9004-96-0) is a chemical compound with the molecular formula C20H38O3 and a molecular weight of 326.5 g/mol. IUPAC name: 2-hydroxyethyl (Z)-octadec-9-enoate. InChIKey: MUHFRORXWCGZGE-KTKRTIGZSA-N.
| Molecular formula | C20H38O3 |
|---|---|
| Molecular weight | 326.5 g/mol |
| IUPAC name | 2-hydroxyethyl (Z)-octadec-9-enoate |
| InChIKey | MUHFRORXWCGZGE-KTKRTIGZSA-N |
| SMILES | CCCCCCCC/C=C\CCCCCCCC(=O)OCCO |
Computed by PubChem (NCBI)
Synonyms:
2-Hydroxyethyl oleate, Glycol oleate, Ethylene glycol monooleate, Glycol monooleate, 9-Octadecenoic acid (Z)-, 2-hydroxyethyl ester, Oleic acid, 2-hydroxyethyl ester, 9-Octadecenoic acid (9Z)-, 2-hydroxyethyl ester, AEC GLYCOL OLEATE, 9-Octadecenoic acid, 2-hydroxyethyl ester, 2-Hydroxyethyl 9-octadecenoate