Products 2290484-49-8

CAS 2290484-49-8 is the registry number for (Z)-3-Hydroxyicos-11-enoic acid, 95%, 95%. Offered by: Chemat. Available pack sizes: 50mg, 100mg, 250mg.

Structural formula: {0} (CAS {1})

(Z)-3-hydroxyicos-11-enoic acid (CAS 2290484-49-8) is a chemical compound with the molecular formula C20H38O3 and a molecular weight of 326.5 g/mol. IUPAC name: (Z)-3-hydroxyicos-11-enoic acid. InChIKey: SBPXXWBTOQUFGY-KTKRTIGZSA-N.

Identity
Molecular formulaC20H38O3
Molecular weight326.5 g/mol
IUPAC name(Z)-3-hydroxyicos-11-enoic acid
InChIKeySBPXXWBTOQUFGY-KTKRTIGZSA-N
SMILESCCCCCCCC/C=C\CCCCCCCC(CC(=O)O)O

Computed by PubChem (NCBI)